RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2174 |
| Common Name | 9-cis-Violaxanthin |
| Formula | C40H56O4 |
| Formula at pH 7.2 (Predicted) | C40H56O4 |
| Molecular Weight | 600.87 |
| Structure |  |
| SMILES | CC2(C1(C(O1)(C)CC(O)C2)C=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4))(C) |
| Reactions | OSR1939 |
| Pathways | |
|---|---|
| KEGG | rn00906 rn01100 rn01110 |
| Database Links | |
|---|---|
| Gramene | CPD-7196 |
| KEGG | C13433 |
| ChEBI | 35305 |