RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2181 |
| Common Name | Cinnamoyl-CoA |
| Formula | C30H42N7O17P3S |
| Formula at pH 7.2 (Predicted) | C30H38N7O17P3S4- |
| Molecular Weight | 897.678 |
| Structure |  |
| SMILES | CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=Cc1(ccccc1))COP(=O)(O)OP(=O)(O)OC[CH]2(O[CH]([CH](O)[CH]2OP(O)(O)=O)n3(c4(c(nc3)c(N)ncn4))) |
| Reactions | OSR1955 OSR1957 OSR2604 OSR2687 OSR2864 OSR2874 |
| Pathways | |
|---|---|
| KEGG | rn00940 rn01100 rn01110 rn00941 rn00945 |
| Metacyc | PWY-5059 PWY-6027 PWY-361 |
| Database Links | |
|---|---|
| KEGG | C00540 |
| ChEBI | 15463 |
| Pubchem Compound | 5280356 |
| Pubchem Substance | 3821 |