RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2182 |
| Common Name | Ubiquinone-6 |
| Synonyms Names | Coenzyme Q6 |
| Formula | C39H58O4 |
| Formula at pH 7.2 (Predicted) | C39H58O4 |
| Molecular Weight | 590.875 |
| Structure |  |
| SMILES | COC1=C(OC)C(=O)C(=C(C1=O)CC=C(CCC=C(CCC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C)C)C)C |
| Reactions | OSR2565 |
| Pathways | |
|---|---|
| KEGG | rn00130 rn01110 |
| Database Links | |
|---|---|
| KEGG | C17568 |
| ChEBI | 52971 |
| Pubchem Compound | 5283544 |
| Pubchem Substance | 96023913 |