RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2185 |
| Common Name | 3-hydroxy-5- oxohexanoyl-CoA |
| Formula | C27H44N7O19P3S1 |
| Formula at pH 7.2 (Predicted) | C27H40N7O19P3S4- |
| Molecular Weight | 895.661 |
| Structure |  |
| SMILES | OC(CC(=O)SCCNC(=O)CCNC(=O)C(C(COP(=O)(OP(=O)(OCC1OC(C(C1OP(=O)(O)O)O)n1cnc2c1ncnc2N)O)O)(C)C)O)CC(=O)C |
| Reactions | OSR2085 OSR2897 |
| Database Links | |
|---|---|
| Gramene | CPD-20 |