RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2187 |
| Common Name | p-Coumaroyl-CoA |
| Synonyms Names | 4-Coumaroyl-CoA ;4-Hydroxycinnamoyl-CoA |
| Formula | C30H42N7O18P3S |
| Formula at pH 7.2 (Predicted) | C30H38N7O18P3S4- |
| Molecular Weight | 913.677 |
| Structure |  |
| SMILES | CC(C)(CO[P](O)(=O)O[P](O)(=O)OCC1OC(C(O)C1O[P](O)(O)=O)[N]2C=NC3=C2N=CN=C3N)C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC4=CC=C(O)C=C4 |
| Reactions | OSR1924 OSR2299 OSR2338 OSR2656 OSR2673 OSR2700 OSR2746 OSR2753 OSR2832 OSR2868 OSR2874 OSR2950 OSR2958 OSR3007 OSR3008 |
| Pathways | |
|---|---|
| KEGG | rn00360 rn00940 rn00941 rn00945 rn01100 rn01110 rn00130 |
| Metacyc | PWY-84 PWY-361 PWY1F-FLAVSYN PWY-5754 PWY-6435 PWY-6673 PWY-6320 PWY-1121 PWY-5135 |
| Database Links | |
|---|---|
| KEGG | C00223 |
| ChEBI | 15499 |
| Pubchem Compound | 5280329 |
| Pubchem Substance | 3523 |