RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2195 |
| Common Name | Caffeoyl-CoA |
| Formula | C30H42N7O19P3S |
| Formula at pH 7.2 (Predicted) | C30H38N7O19P3S4- |
| Molecular Weight | 929.676 |
| Structure |  |
| SMILES | C(CC(=O)NCCSC(=O)C=Cc1(cc(O)c(O)cc1))NC(=O)C(O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[CH]2(O[CH]([CH](O)[CH]2OP(=O)(O)O)n3(c4(c(nc3)c(N)ncn4))) |
| Reactions | OSR1924 OSR2313 OSR2355 OSR2616 OSR2638 OSR2714 OSR2842 OSR2844 OSR2876 OSR2939 OSR2981 |
| Pathways | |
|---|---|
| KEGG | rn00360 rn00940 rn00941 rn00945 rn01100 rn01110 |
| Metacyc | PWY-361 PWY-1121 PWY-5307 |
| Database Links | |
|---|---|
| KEGG | C00323 |
| ChEBI | 15518 |
| Pubchem Compound | 5280336 |
| Pubchem Substance | 3617 |