RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2201 |
| Common Name | Uroporphyrinogen I |
| Formula | C40H44N4O16 |
| Formula at pH 7.2 (Predicted) | C40H36N4O168- |
| Molecular Weight | 836.795 |
| Structure |  |
| SMILES | OC(=O)Cc1c2Cc3[nH]c(c(c3CCC(=O)O)CC(=O)O)Cc3[nH]c(Cc4[nH]c(Cc(c1CCC(=O)O)[nH]2)c(CC(=O)O)c4CCC(=O)O)c(c3CCC(=O)O)CC(=O)O |
| Reactions | OSR1866 |
| Pathways | |
|---|---|
| KEGG | rn00860 |
| Database Links | |
|---|---|
| KEGG | C05766 |
| ChEBI | 28766 |
| Pubchem Compound | 440775 |
| Pubchem Substance | 8061 |