RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2208 |
| Common Name | Feruloyl-CoA |
| Synonyms Names | trans-Feruloyl-CoA |
| Formula | C31H44N7O19P3S |
| Formula at pH 7.2 (Predicted) | C31H40N7O19P3S4- |
| Molecular Weight | 943.703 |
| Structure |  |
| SMILES | [CH]3(n1(c2(c(nc1)c(N)ncn2)))(O[CH]([CH]([CH](O)3)OP(=O)(O)O)COP(=O)(O)OP(O)(=O)OCC(C)(C)C(O)C(=O)NCCC(=O)NCCSC(=O)C=Cc4(cc(OC)c(O)cc4)) |
| Reactions | OSR2334 OSR2616 OSR2686 OSR2758 OSR2886 |
| Pathways | |
|---|---|
| KEGG | rn00360 rn00940 rn00941 rn00945 rn01100 rn01110 |
| Metacyc | PWY-361 PWY-1121 PWY-6027 |
| Database Links | |
|---|---|
| KEGG | C00406 |
| ChEBI | 15511 |
| Pubchem Compound | 5280347 |
| Pubchem Substance | 3696 |