RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2211 |
| Common Name | 5-Hydroxyferuloyl-CoA |
| Formula | C31H44N7O20P3S |
| Formula at pH 7.2 (Predicted) | C31H40N7O20P3S4- |
| Molecular Weight | 959.702 |
| Structure |  |
| SMILES | CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=Cc1(cc(OC)c(O)c(c1)O))COP(O)(=O)OP(=O)(O)OC[CH]2(O[CH]([CH](O)[CH]2OP(=O)(O)O)n3(c4(c(nc3)c(N)ncn4))) |
| Reactions | OSR2689 OSR2701 OSR2896 |
| Pathways | |
|---|---|
| KEGG | rn00940 rn01100 rn01110 |
| Database Links | |
|---|---|
| KEGG | C12203 |
| ChEBI | 31136 |
| Pubchem Compound | 656999 |
| Pubchem Substance | 14349 |