RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2213 |
| Common Name | Hydroxymethylbilane |
| Formula | C40H46N4O17 |
| Formula at pH 7.2 (Predicted) | C40H38N4O178- |
| Molecular Weight | 854.81 |
| Structure |  |
| SMILES | c1(nc(c(CCC(O)=O)c1CC(=O)O)Cc2(nc(c(CC(O)=O)c2CCC(=O)O)Cc3(nc(c(CC(=O)O)c3CCC(O)=O)Cc4(c(CCC(=O)O)c(CC(O)=O)c(n4)CO)))) |
| Reactions | OSR2046 OSR2294 |
| Pathways | |
|---|---|
| KEGG | rn00860 rn01100 rn01110 |
| Metacyc | PWY-5188 |
| Database Links | |
|---|---|
| KEGG | C01024 |
| ChEBI | 16645 |