RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2217 |
| Common Name | 2-Succinylbenzoyl-CoA |
| Synonyms Names | o-Succinylbenzoyl-CoA ;Succinylbenzoyl-CoA |
| Formula | C32H44N7O20P3S |
| Formula at pH 7.2 (Predicted) | C32H39N7O20P3S5- |
| Molecular Weight | 971.713 |
| Structure |  |
| SMILES | c1(c2(c(ncn1)n(cn2)C3(OC(C(C(O)3)OP(O)(=O)O)COP(O)(=O)OP(=O)(O)OCC(C)(C)C(O)C(=O)NCCC(=O)NCCSC(=O)c4(c(cccc4)C(=O)CCC(=O)O))))(N) |
| Reactions | OSR2052 OSR2710 |
| Pathways | |
|---|---|
| KEGG | rn00130 rn01100 rn01110 |
| Metacyc | MENAQUINONESYN-PWY |
| Database Links | |
|---|---|
| KEGG | C03160 |
| ChEBI | 15509 |