RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2234 |
| Common Name | Sinapoyl-CoA |
| Formula | C32H46N7O20P3S |
| Formula at pH 7.2 (Predicted) | C32H42N7O20P3S4- |
| Molecular Weight | 973.729 |
| Structure |  |
| SMILES | COc1cc(C=CC(=O)SCCNC(=O)CCNC(=O)C(C(COP(=O)(OP(=O)(OCC2OC(C(C2OP(=O)(O)O)O)n2cnc3c2ncnc3N)O)O)(C)C)O)cc(c1O)OC |
| Reactions | OSR2689 OSR2747 OSR2912 |
| Pathways | |
|---|---|
| KEGG | rn00940 rn01100 rn01110 |
| Database Links | |
|---|---|
| KEGG | C00411 |
| ChEBI | 15540 |
| Pubchem Compound | 5326801 |
| Pubchem Substance | 3701 |