RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2247 |
| Common Name | delphinidin 3-O-glucosyl-5-O-caffeoylglucoside-3'-O-glucoside |
| Formula | C42H47O25 |
| Formula at pH 7.2 (Predicted) | C42H46O25 |
| Molecular Weight | 951.818 |
| Structure |  |
| SMILES | C1=CC(=C(C=C1C=CC(=O)OCC2C(C(C(C(O2)OC3=CC(=O)C=C4C3=CC(=C(O4)C5=CC(=C(C(=C5)OC6C(C(C(C(O6)CO)O)O)O)O)O)OC7C(C(C(C(O7)CO)O)O)O)O)O)O)O)O |
| Reactions | OSR2652 OSR2939 OSR2981 |
| Pathways | |
|---|---|
| Metacyc | PWY-5307 |
| Database Links | |
|---|---|
| Gramene | CPD-7963 |