RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2248 |
| Common Name | precorrin-3B |
| Formula | C43H50N4O17 |
| Formula at pH 7.2 (Predicted) | C43H44N4O176- |
| Molecular Weight | 894.885 |
| Structure |  |
| SMILES | OC(=O)CCC1=C2Cc3[nH]c(c(c3CC(=O)O)CCC(=O)O)Cc3[nH]c(C(C45NC(=CC(=N2)C1(C)CC(=O)O)C(CCC(=O)O)C4(C)CC(=O)O5)(C)O)c(c3CCC(=O)O)CC(=O)O |
| Reactions | OSR2783 OSR2914 |
| Database Links | |
|---|---|
| Gramene | CPD-643 |