RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2253 |
| Common Name | Heme A |
| Formula | C49H56FeN4O6 |
| Formula at pH 7.2 (Predicted) | C49H56N4O6 |
| Molecular Weight | 852.837 |
| Structure |  |
| SMILES | C=CC1=C(C)C2=Cc3[n-]c(c(c3C(CCC=C(CCC=C(CCC=C(C)C)C)C)O)C)C=C3N=C(C=c4[n-]c(=CC1=N2)c(C)c4CCC(=O)O)C(=C3C=O)CCC(=O)O.[Fe+2] |
| Reactions | OSR2235 |
| Pathways | |
|---|---|
| KEGG | rn00860 rn01110 |
| Database Links | |
|---|---|
| KEGG | C15670 |
| Pubchem Compound | 46173807 |
| Pubchem Substance | 47204997 |