RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2263 |
| Common Name | (3R,2'S)-Myxol 2'-alpha-L-fucoside |
| Formula | C46H66O7 |
| Formula at pH 7.2 (Predicted) | C46H66O7 |
| Molecular Weight | 731.012 |
| Structure |  |
| SMILES | CC(=CC=CC=C(C=CC=C(C=CC1=C(C)CC(CC1(C)C)O)C)C)C=CC=C(C=CC=C(C=CC(C(O)(C)C)OC1OC(C)C(C(C1O)O)O)C)C |
| Reactions | OSR2255 |
| Pathways | |
|---|---|
| KEGG | rn00906 |
| Database Links | |
|---|---|
| KEGG | C15941 |
| Pubchem Compound | 23724612 |
| Pubchem Substance | 47205257 |