RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2268 |
| Common Name | precorrin-5 |
| Formula | C45H54N4O17 |
| Formula at pH 7.2 (Predicted) | C45H47N4O177- |
| Molecular Weight | 922.938 |
| Structure |  |
| SMILES | OC(=O)CCC1C2=CC3=NC(=C(C3(C)CC(=O)O)CCC(=O)O)CC3(C)N=C(CC4=NC(=C(CC(=O)O)C4(C)CCC(=O)O)C(C1(C)CC(=O)O)(N2)C(=O)C)C(=C3CC(=O)O)CCC(=O)O |
| Reactions | OSR2798 OSR2821 |
| Database Links | |
|---|---|
| Gramene | CPD-662 |