RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2287 |
| Common Name | menaquinone-8 |
| Formula | C51H72O2 |
| Formula at pH 7.2 (Predicted) | C51H72O2 |
| Molecular Weight | 717.129 |
| Structure |  |
| SMILES | CC(=CCCC(=CCCC(=CCCC(=CCC1=C(C)C(=O)c2c(C1=O)cccc2)C)C)C)CCC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C |
| Reactions | OSR2414 OSR2511 OSR2815 |
| Pathways | |
|---|---|
| Metacyc | ANARESPDON-PWY PWY-1881 |