RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2305 |
| Common Name | maltohexaose |
| Formula | C36H62O31 |
| Formula at pH 7.2 (Predicted) | C36H62O31 |
| Molecular Weight | 990.867 |
| Structure |  |
| SMILES | OCC1OC(OC2C(CO)OC(C(C2O)O)OC2C(CO)OC(C(C2O)O)O)C(C(C1OC1OC(CO)C(C(C1O)O)OC1OC(CO)C(C(C1O)O)OC1OC(CO)C(C(C1O)O)O)O)O |
| Reactions | OSR1346 OSR1371 OSR2481 OSR2730 |
| Pathways | |
|---|---|
| KEGG | rn00052 rn01100 rn00500 |
| Metacyc | GLYCOCAT-PWY PWY-842 PWY-5941 |