RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2323 |
| Common Name | 18:2-18:3-MGDG |
| Formula | C45H76O11 |
| Formula at pH 7.2 (Predicted) | C45H76O11 |
| Molecular Weight | 793.089 |
| Structure |  |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)OCC(OC(=O)CCCCCCCC=CCC=CCC=CCC)COC1OC(CO)C(C(C1O)O)OO |
| Reactions | OSR2415 OSR2447 |
| Pathways | |
|---|---|
| Metacyc | PWY-782 |
| Database Links | |
|---|---|
| Gramene | CPD-8166 |