RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2325 |
| Common Name | gentiodelphin |
| Formula | C51H53O28 |
| Formula at pH 7.2 (Predicted) | C51H52O28 |
| Molecular Weight | 1113.963 |
| Structure |  |
| SMILES | C1=CC(=C(C=C1C=CC(=O)OCC2C(C(C(C(O2)OC3=CC(=CC(=C3O)O)C4=C(C=C5C(=CC(=O)C=C5OC6C(C(C(C(O6)COC(=O)C=CC7=CC(=C(C=C7)O)O)O)O)O)O4)OC8C(C(C(C(O8)CO)O)O)O)O)O)O)O)O |
| Reactions | OSR2981 |
| Database Links | |
|---|---|
| Gramene | CPD-7965 |