RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2331 |
| Common Name | 3-Nonaprenyl-4-hydroxybenzoate |
| Synonyms Names | Nonaprenyl-4-hydroxybenzoate |
| Formula | C52H78O3 |
| Formula at pH 7.2 (Predicted) | C52H77O3- |
| Molecular Weight | 751.174 |
| Structure |  |
| SMILES | CC(=CCCC(=CCCC(=CCCC(=CCc1cc(ccc1O)C(=O)O)C)C)C)CCC=C(CCC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C)C |
| Reactions | OSR2551 |
| Pathways | |
|---|---|
| KEGG | rn00130 rn01110 |
| Database Links | |
|---|---|
| KEGG | C03885 |
| ChEBI | 18162 |
| Pubchem Compound | 6443777 |
| Pubchem Substance | 6618 |