RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2340 |
| Common Name | N,N'-Diacetylchitobiosyldiphosphodolichol |
| Synonyms Names | Chitobiosyldiphosphodolichol ;(N-acetylglucosaminyl)2-diphosphodolichol |
| Formula | C41H72N2O17P2; C96H160N2O17P2 |
| Formula at pH 7.2 (Predicted) | C41H70N2O17P22- |
| Molecular Weight | 1676.271 |
| SMILES | OCC1OC(OP(=O)(OP(=O)(OCCC(CCC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C)C)O)O)C(C(C1OC1OC(CO)C(C(C1NC(=O)C)O)O)O)NC(=O)C; |
| Reactions | OSR2940 OSR3015 OSR3022 |
| Pathways | |
|---|---|
| KEGG | rn00510 rn00513 rn01100 |
| Database Links | |
|---|---|
| KEGG | C04537 |
| ChEBI | 12427 |
| Pubchem Compound | 24892751 |
| Pubchem Substance | 7144 |