RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2346 |
| Common Name | 18:2-18:2-PC |
| Formula | C44H81N1O8P1 |
| Formula at pH 7.2 (Predicted) | C44H80NO8P |
| Molecular Weight | 783.1 |
| Structure |  |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)OCC(OC(=O)CCCCCCCC=CCC=CCCCCC)COP(=O)(OCC[N+](C)(C)C)O |
| Reactions | OSR2453 OSR2458 OSR2468 OSR2469 |
| Database Links | |
|---|---|
| Gramene | CPD-2182 |
| Pubchem Compound | 5313522 |