RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2353 |
| Common Name | 3-Demethylubiquinone-9 |
| Formula | C53H80O4 |
| Formula at pH 7.2 (Predicted) | C53H80O4 |
| Molecular Weight | 781.2 |
| Structure |  |
| SMILES | COC1=C(O)C(=C(C(=O)C1=O)C)CC=C(CCC=C(CCC=C(CCC=C(CCC=C(CCC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C)C)C)C)C)C |
| Reactions | OSR2900 |
| Pathways | |
|---|---|
| KEGG | rn00130 |
| Database Links | |
|---|---|
| KEGG | C03226 |
| ChEBI | 18238 |
| Pubchem Compound | 11953820 |
| Pubchem Substance | 6098 |