RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2356 |
| Common Name | 18:1-18:2-PC |
| Formula | C44H83N1O8P1 |
| Formula at pH 7.2 (Predicted) | C44H82NO8P |
| Molecular Weight | 785.115 |
| Structure |  |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC(OC(=O)CCCCCCCC=CCC=CCCCCC)COP(=O)(OCC[N+](C)(C)C)O |
| Reactions | OSR2468 OSR2475 OSR2492 |
| Database Links | |
|---|---|
| Gramene | CPD-8091 |
| Pubchem Compound | 5313480 |