RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2357 |
| Common Name | Chlorophyll a |
| Synonyms Names | chlorophyll a ;chlorophyll |
| Formula | C55H72MgN4O5 |
| Formula at pH 7.2 (Predicted) | C55H71MgN4O5- |
| Molecular Weight | 893.489 |
| Structure |  |
| SMILES | CCC1=C(C)C/2=C/C3=C(C=C)C(=C4C=C5/N=C(C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C5C)C6=C7N([Mg][N]34)C(=C/C1=N2)C(=C7C(=O)C6C(=O)OC)C)C |
| Reactions | OSR2502 OSR2505 OSR2947 OSR2976 OSR2984 |
| Pathways | |
|---|---|
| KEGG | rn00860 rn01100 rn01110 |
| Metacyc | PWY-5098 PWY-5064 |
| Database Links | |
|---|---|
| KEGG | C05306 |
| ChEBI | 18230 |
| Pubchem Compound | 12085802 |
| Pubchem Substance | 7688 |