RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2360 |
| Common Name | chlorophyll b |
| Formula | C55H70N4O6MG1; C55H70MgN4O6 |
| Formula at pH 7.2 (Predicted) | C55H70MgN4O6 |
| Molecular Weight | 907.486 |
| SMILES | COC(=O)C1C2=c3c(C1=O)c(c1=Cc4n5[Mg]6([N]7=C2C(CCC(=O)OCC=C(CCCC(CCCC(CCCC(C)C)C)C)C)C(C7=Cc2n6c(C=c5c(c4CC)C=O)c(c2C)C=C)C)n31)C; COC(=O)C1C2=C3N=C(C(C3CCC(=O)OCC=C(CCCC(CCCC(CCCC(C)C)C)C)C)C)C=c3[n-]c(=CC4=NC(=Cc5[n-]c2c(C1=O)c5C)C(=C4C=O)CC)c(c3C)C=C.[Mg+2] |
| Reactions | OSR2502 OSR2510 OSR2599 OSR2935 OSR2967 OSR2979 OSR2985 |
| Pathways | |
|---|---|
| KEGG | rn00860 rn01100 rn01110 |
| Metacyc | PWY-5068 |
| Database Links | |
|---|---|
| KEGG | C05307 |
| ChEBI | 27888 |
| Pubchem Compound | 46173742 |
| Pubchem Substance | 7689 |