RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2361 |
| Common Name | pheophytin a |
| Formula | C55H74N4O5 |
| Formula at pH 7.2 (Predicted) | C55H73N4O5- |
| Molecular Weight | 871.213 |
| Structure |  |
| SMILES | COC(=O)C1C(=O)C2=C(C)C3=NC2=C1C1=NC(=Cc2[nH]c(c(c2C)C=C)C=c2[nH]c(=C3)c(CC)c2C)C(C1CCC(=O)OCC=C(CCCC(CCCC(CCCC(C)C)C)C)C)C |
| Reactions | OSR2513 |
| Database Links | |
|---|---|
| Gramene | CPD-8155 |