RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2365 |
| Common Name | 18:1-18:1-PC |
| Formula | C44H85N1O8P1 |
| Formula at pH 7.2 (Predicted) | C44H84NO8P |
| Molecular Weight | 787.131 |
| Structure |  |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP(=O)(OCC[N+](C)(C)C)O |
| Reactions | OSR2492 OSR2493 |
| Database Links | |
|---|---|
| Gramene | CPD-2181 |
| Pubchem Compound | 5313476 |