RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2367 |
| Common Name | 7-hydroxy-chlorophyll a |
| Formula | C55H72N4O6MG1 |
| Formula at pH 7.2 (Predicted) | C55H72MgN4O6 |
| Molecular Weight | 909.502 |
| Structure |  |
| SMILES | COC(=O)C1C2=c3c(C1=O)c(c1=Cc4n5[Mg]6([N]7=C2C(CCC(=O)OCC=C(CCCC(CCCC(CCCC(C)C)C)C)C)C(C7=Cc2n6c(C=c5c(c4CC)CO)c(c2C)C=C)C)n31)C |
| Reactions | OSR2984 OSR2985 |
| Database Links | |
|---|---|
| Gramene | CPD-7016 |