RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2368 |
| Common Name | Ubiquinone-9 |
| Synonyms Names | Ubiquinone-45 ;Coenzyme Q(9) |
| Formula | C54H82O4 |
| Formula at pH 7.2 (Predicted) | C54H82O4 |
| Molecular Weight | 795.226 |
| Structure |  |
| SMILES | COC1=C(OC)C(=O)C(=C(C1=O)CC=C(CCC=C(CCC=C(CCC=C(CCC=C(CCC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C)C)C)C)C)C)C |
| Reactions | OSR2900 OSR2974 |
| Pathways | |
|---|---|
| KEGG | rn00130 |
| Database Links | |
|---|---|
| KEGG | C01967 |
| ChEBI | 18160 |
| Pubchem Compound | 5280473 |
| Pubchem Substance | 5068 |