RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2369 |
| Common Name | Bacterio-chlorophyll a |
| Formula | C55H74MgN4O6 |
| Formula at pH 7.2 (Predicted) | C55H75N4O6+ |
| Molecular Weight | 911.504 |
| Structure |  |
| SMILES | COC(=O)C1C2=C3N=C(C(C3CCC(=O)OCC=C(CCCC(CCCC(CCCC(C)C)C)C)C)C)C=c3[n-]c(=CC4=NC(=Cc5[n-]c2c(C1=O)c5C)C(CC)C4C)c(c3C)C(=O)C.[Mg+2] |
| Reactions | OSR2999 |
| Pathways | |
|---|---|
| KEGG | rn00860 |
| Database Links | |
|---|---|
| KEGG | C11242 |
| ChEBI | 30033 |
| Pubchem Compound | 11953947 |
| Pubchem Substance | 13420 |