RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2383 |
| Common Name | tRNA uridine |
| Formula | C37H49N13O32R11P5 |
| Formula at pH 7.2 (Predicted) | C37H43O32N13P5R1 |
| Structure |  |
| SMILES | c1(c2(ncn(c(ncn1)2)C3(C(C(C(O3)COP(OC4(C(C(OC4COP(OC5(C(OC(C5O)n6(c(nc(cc6)N)=O))COP(=O)(O)O[R1]))(=O)O)n7(c(nc(cc7)N)=O))O))(=O)O)OP(OCC8(C(C(C(O8)n9(ccc(nc(=O)9)=O))O)OP(O)(O)=O))(O)=O)O)))N |
| Reactions | OSR2634 |
| Database Links | |
|---|---|
| Gramene | CPD-8538 |