RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2400 |
| Common Name | 6-Oxo-2-hydroxycyclohexane-1-carboxyl-CoA |
| Formula | C47H82N2O22P2 |
| Formula at pH 7.2 (Predicted) | C28H40N7O19P3S4- |
| Molecular Weight | 907.671 |
| Structure |  |
| SMILES | O=C(NCCSC(=O)C1C(O)CCCC1=O)CCNC(=O)C(C(COP(=O)(OP(=O)(OCC1OC(C(C1OP(=O)(O)O)O)n1cnc2c1ncnc2N)O)O)(C)C)O |
| Reactions | OSR2800 |
| Database Links | |
|---|---|
| KEGG | C09825 |
| ChEBI | 28011 |
| Pubchem Compound | 442453 |
| Pubchem Substance | 12013 |