RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2430 |
| Common Name | maltodecaose |
| Formula | C60H102O51 |
| Formula at pH 7.2 (Predicted) | C60H102O51 |
| Structure |  |
| SMILES | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)OC4C(OC(C(C4O)O)OC5C(OC(C(C5O)O)OC6C(OC(C(C6O)O)OC7C(OC(C(C7O)O)OC8C(OC(C(C8O)O)OC9C(OC(C(C9O)O)OC1C(OC(C(C1O)O)O)CO)CO)CO)CO)CO)CO)CO)CO)CO)O)O)O)O |
| Reactions | OSR2987 |
| Pathways | |
|---|---|
| KEGG | rn00500 |
| Metacyc | GLYCOCAT-PWY PWY-5941 PWY-842 |