RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2446 |
| Common Name | (GlcNAc)2 (Man)7 (PP-Dol)1 |
| Synonyms Names | G10596 |
| Formula | C83H142N2O52P2 |
| Formula at pH 7.2 (Predicted) | C83H140N2O52P22- |
| Mass | 1541.4 (PP-Dol) |
| SMILES | CC(CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)CCOP(=O)(O)OP(=O)(O)OC1C(C(C(C(O1)CO)OC2C(C(C(C(O2)CO)OC3C(C(C(C(O3)COC4C(C(C(C(O4)CO)O)OC5C(C(C(C(O5)CO)O)O)OC6C(C(C(C(O6)CO)O)O)O)O)O)OC7C(C(C(C(O7)CO)O)O)OC8C(C(C(C(O8)CO)O)O)OC9C(C(C(C(O9)CO)O)O)O)O)O)NC(=O)C)O)NC(=O)C |
| Reactions | OSR3042 OSR3046 |
| Pathways | |
|---|---|
| KEGG | rn00510 rn01100 rn00513 |
| Database Links | |
|---|---|
| KEGG | G10596 |
| Pubchem Substance | 124499747 |