RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2450 |
| Common Name | (GlcNAc)2 (Man)8 (PP-Dol)1 |
| Synonyms Names | G10597 |
| Formula | C89H152N2O57P2 |
| Formula at pH 7.2 (Predicted) | C89H150N2O57P22- |
| Mass | 1703.5 (PP-Dol) |
| SMILES | CC(CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)CCOP(=O)(O)OP(=O)(O)OC1C(C(C(C(O1)CO)OC2C(C(C(C(O2)CO)OC3C(C(C(C(O3)COC4C(C(C(C(O4)COC5C(C(C(C(O5)CO)O)O)O)O)OC6C(C(C(C(O6)CO)O)O)OC7C(C(C(C(O7)CO)O)O)O)O)O)OC8C(C(C(C(O8)CO)O)O)OC9C(C(C(C(O9)CO)O)O)OC1C(C(C(C(O1)CO)O)O)O)O)O)NC(=O)C)O)NC(=O)C |
| Reactions | OSR3046 OSR3047 |
| Pathways | |
|---|---|
| KEGG | rn00510 rn00513 rn01100 |
| Database Links | |
|---|---|
| KEGG | G10597 |
| Pubchem Substance | 124499748 |