RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2505 |
| Common Name | L-histidyl-tRNAHis |
| Synonyms Names | L-HISTIDYL-TRNA(HIS) ;L-Histidyl-tRNA(His) ;C02988 |
| Structure |  |
| SMILES | NC(CC(O)=O)C(=O)OC1C(O)C(OC1CO[P](O)(=O)OC2C(O)C(OC2CO[P](O)(=O)OC3C(O)C(OC3CO)[R])[R])[R] |
| Reactions | OSR2740 |
| Pathways | |
|---|---|
| KEGG | rn00970 |
| Metacyc | TRNA-CHARGING-PWY |
| Database Links | |
|---|---|
| KEGG | C02988 |
| Pubchem Substance | 5897 |