RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2634 |
| Common Name | L-CYSTEINYL-TRNA(CYS) |
| Synonyms Names | L-Cysteinyl-tRNA(Cys) ;C03125 |
| Structure |  |
| SMILES | CC(O)C(N)C(=O)OC1C(O)C(OC1CO[P](O)(=O)OC2C(O)C(OC2CO[P](O)(=O)OC3C(O)C(OC3CO)[R])[R])[R] |
| Reactions | OSR2695 |
| Pathways | |
|---|---|
| KEGG | rn00970 |
| Metacyc | TRNA-CHARGING-PWY |
| Database Links | |
|---|---|
| KEGG | C03125 |
| Pubchem Substance | 6018 |