RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2722 |
| Common Name | L-seryl-SEC-tRNAs |
| Synonyms Names | L-Seryl-tRNA(Sec) ;C06481 |
| Structure |  |
| SMILES | NC(CC(O)=O)C(=O)OC1C(O)C(OC1CO[P](O)(=O)OC2C(O)C(OC2CO[P](O)(=O)OC3C(O)C(OC3CO)[R])[R])[R] |
| Reactions | OSR2097 OSR2691 |
| Pathways | |
|---|---|
| KEGG | rn00970 |
| Metacyc | PWY0-901 |
| Database Links | |
|---|---|
| KEGG | C06481 |
| Pubchem Substance | 8712 |