RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2728 |
| Common Name | L-Tyrosyl-tRNA(Tyr) |
| Synonyms Names | C02839 ;L-TYROSYL-TRNA(TYR) |
| Structure |  |
| SMILES | OCC1OC(C(O)C1O[P](O)(=O)OCC2OC(C(O)C2O[P](O)(=O)OCC3OC(C(O)C3OC(=O)C4CCCN4)[R])[R])[R] |
| Reactions | OSR2767 |
| Pathways | |
|---|---|
| KEGG | rn00970 |
| Metacyc | TRNA-CHARGING-PWY |
| Database Links | |
|---|---|
| KEGG | C02839 |
| Pubchem Substance | 5781 |