RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2739 |
| Common Name | ASN-tRNAs |
| Synonyms Names | tRNA(Asn) |
| Formula | C14H23N2O12PR2(C5H8O6PR)n |
| Formula at pH 7.2 (Predicted) | C19H29O18N2P2R3 |
| SMILES | NC(CC(N)=O)C(=O)OC1C(O)C(OC1CO[P](O)(=O)OC2C(O)C(OC2CO[P](O)(=O)OC3C(O)C(OC3CO)[R])[R])[R]; none |
| Reactions | OSR2718 |
| Pathways | |
|---|---|
| KEGG | rn00970 |
| Metacyc | TRNA-CHARGING-PWY |
| Database Links | |
|---|---|
| KEGG | C01637 |
| Pubchem Substance | 4786 |