RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2773 |
| Common Name | L-Threonyl-tRNA(Thr) |
| Synonyms Names | C02992 ;L-THREONYL-TRNA(THR) |
| Structure |  |
| SMILES | NC(CC1=C[NH]C=N1)C(=O)OC2C(O)C(OC2CO[P](O)(=O)OC3C(O)C(OC3CO[P](O)(=O)OC4C(O)C(OC4CO)[R])[R])[R] |
| Reactions | OSR2717 |
| Pathways | |
|---|---|
| KEGG | rn00970 |
| Metacyc | TRNA-CHARGING-PWY |
| Database Links | |
|---|---|
| KEGG | C02992 |
| Pubchem Substance | 5901 |